Difference between revisions of "ADENYL-KIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-650 CPD-650] == * smiles: ** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4210 RXN-4210] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-650 CPD-650] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4210 RXN-4210] ==
−
* smiles:
+
* direction:
−
** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=QHHKKMYHDBRONY-WZZMXTMRSA-J
+
** [http://enzyme.expasy.org/EC/1.3.1.21 EC-1.3.1.21]
−
* common name:
+
−
** (3R)-3-hydroxybutanoyl-CoA
+
−
* molecular weight:
+
−
** 849.593   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-OH-butyryl-CoA
 
−
** OH-butyryl-CoA
 
−
** β-hydroxybutyryl-S-CoA
 
−
** D-3-hydroxybutyryl-CoA
 
−
** hydroxy-butyryl-CoA
 
−
** β-hydroxybutyryl-CoA
 
−
** 3-hydroxybutyryl-CoA
 
−
** (3R)-3-Hydroxybutanoyl-CoA
 
−
** 3-hydroxybutanoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-5901]]
+
** 1 [[PROTON]][c] '''+''' 1 [[CPD-4126]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-4127]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 5-dehydroavenasterol[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 isofucosterol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_8982]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
 +
** '''10''' reactions found over '''36''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266552 45266552]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07487 R07487]
−
* UM-BBD-CPD : c0030
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.1.21}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57315 57315]
+
{{#set: gene associated=Tiso_gene_8982}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-2541}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03561 C03561]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB01166
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: inchi key=InChIKey=QHHKKMYHDBRONY-WZZMXTMRSA-J}}
+
−
{{#set: common name=(3R)-3-hydroxybutanoyl-CoA}}
+
−
{{#set: molecular weight=849.593    }}
+
−
{{#set: common name=3-OH-butyryl-CoA|OH-butyryl-CoA|β-hydroxybutyryl-S-CoA|D-3-hydroxybutyryl-CoA|hydroxy-butyryl-CoA|β-hydroxybutyryl-CoA|3-hydroxybutyryl-CoA|(3R)-3-Hydroxybutanoyl-CoA|3-hydroxybutanoyl-CoA}}
+
−
{{#set: produced by=RXN-5901}}
+

Revision as of 17:14, 10 January 2018

Reaction RXN-4210

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 5-dehydroavenasterol[c] + 1 NADPH[c] => 1 NADP+[c] + 1 isofucosterol[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2541, plant sterol biosynthesis: PWY-2541
    • 10 reactions found over 36 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ADENYL-KIN-RXN&oldid=16792"