Difference between revisions of "2.7.12.1-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2006 RXN-2006] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2006 RXN-2006] ==
−
* smiles:
+
* direction:
−
** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NHVNXKFIZYSCEB-XLPZGREQSA-J
+
−
* common name:
+
−
** dTTP
+
−
* molecular weight:
+
−
** 478.139   
+
 
* Synonym(s):
 
* Synonym(s):
−
** thymidine triphosphate
 
−
** thymidine 5'-triphosphate
 
−
** TTP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[DTTGY]]
+
* With identifiers:
−
* [[RXN0-5107]]
+
** 1 [[CO-A]][c] '''+''' 1 [[CPD-514]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[BENZOYLCOA]][c]
−
* [[RME255]]
+
* With common name(s):
−
* [[DTTUP]]
+
** 1 coenzyme A[c] '''+''' 1 3-oxo-3-phenylpropanoyl-CoA[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 benzoyl-CoA[c]
−
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
+
 
−
* [[RXN-14200]]
+
== Genes associated with this reaction  ==
−
* [[DTNH]]
+
Genes have been associated with this reaction based on different elements listed below.
−
== Reaction(s) known to produce the compound ==
+
* [[Tiso_gene_16181]]
−
* [[ATDTDm]]
+
** [[pantograph]]-[[athaliana]]
−
* [[ATDTD]]
+
** [[pantograph]]-[[esiliculosus]]
−
* [[DTDPKIN-RXN]]
+
== Pathways  ==
−
== Reaction(s) of unknown directionality ==
+
* [[P281-PWY]], 3-phenylpropanoate degradation: [http://metacyc.org/META/NEW-IMAGE?object=P281-PWY P281-PWY]
−
* [[DTDPGLUCOSEPP-RXN]]
+
** '''1''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-481]], ethylbenzene degradation (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-481 PWY-481]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6443]], benzoate biosynthesis I (CoA-dependent, β-oxidative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6443 PWY-6443]
 +
** '''2''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-6458]], benzoyl-CoA biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6458 PWY-6458]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[athaliana]]
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* CAS : 365-08-2
+
* LIGAND-RXN:
−
* METABOLIGHTS : MTBLC37568
+
** [http://www.genome.jp/dbget-bin/www_bget?R05506 R05506]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11988283 11988283]
+
{{#set: gene associated=Tiso_gene_16181}}
−
* HMDB : HMDB01342
+
{{#set: in pathway=P281-PWY|PWY-481|PWY-6443|PWY-6458}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00459 C00459]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=athaliana|esiliculosus}}
−
** [http://www.chemspider.com/Chemical-Structure.10160750.html 10160750]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37568 37568]
+
−
* BIGG : dttp
+
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O2))}}
+
−
{{#set: inchi key=InChIKey=NHVNXKFIZYSCEB-XLPZGREQSA-J}}
+
−
{{#set: common name=dTTP}}
+
−
{{#set: molecular weight=478.139    }}
+
−
{{#set: common name=thymidine triphosphate|thymidine 5'-triphosphate|TTP}}
+
−
{{#set: consumed by=DTTGY|RXN0-5107|RME255|DTTUP|THYMIDINE-TRIPHOSPHATASE-RXN|RXN-14200|DTNH}}
+
−
{{#set: produced by=ATDTDm|ATDTD|DTDPKIN-RXN}}
+
−
{{#set: consumed or produced by=DTDPGLUCOSEPP-RXN}}
+

Revision as of 17:14, 10 January 2018

Reaction RXN-2006

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 3-oxo-3-phenylpropanoyl-CoA[c] => 1 acetyl-CoA[c] + 1 benzoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • P281-PWY, 3-phenylpropanoate degradation: P281-PWY
    • 1 reactions found over 9 reactions in the full pathway
  • PWY-481, ethylbenzene degradation (anaerobic): PWY-481
    • 2 reactions found over 5 reactions in the full pathway
  • PWY-6443, benzoate biosynthesis I (CoA-dependent, β-oxidative): PWY-6443
    • 2 reactions found over 9 reactions in the full pathway
  • PWY-6458, benzoyl-CoA biosynthesis: PWY-6458
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.7.12.1-RXN&oldid=16815"