Difference between revisions of "RXNQT-4178"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] == * smiles: ** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O) * inchi key: ** InChIKey=BXRF...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18752 == * left end position: ** 415 * transcription direction: ** NEGATIVE * right end position: ** 2753 * centisome position: ** 14.73721...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] ==
+
== Gene Tiso_gene_18752 ==
−
* smiles:
+
* left end position:
−
** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)
+
** 415
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-nitrobenzaldehyde
+
** 2753
−
* molecular weight:
+
* centisome position:
−
** 151.121    
+
** 14.737216    
 
* Synonym(s):
 
* Synonym(s):
−
** 4NBZ
 
−
** p-nitrobenzaldehyde
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-5141]]
+
* [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* CAS : 555-16-8
+
{{#set: left end position=415}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=541 541]
+
{{#set: right end position=2753}}
−
* CHEMSPIDER:
+
{{#set: centisome position=14.737216   }}
−
** [http://www.chemspider.com/Chemical-Structure.526.html 526]
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-7511}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66926 66926]
+
−
* NCI:
+
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6103 6103]
+
−
{{#set: smiles=C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N}}
+
−
{{#set: common name=4-nitrobenzaldehyde}}
+
−
{{#set: molecular weight=151.121   }}
+
−
{{#set: common name=4NBZ|p-nitrobenzaldehyde}}
+
−
{{#set: consumed by=RXN0-5141}}
+

Revision as of 18:14, 10 January 2018

Gene Tiso_gene_18752

  • left end position:
    • 415
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2753
  • centisome position:
    • 14.737216
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXNQT-4178&oldid=16846"