Difference between revisions of "Tiso gene 15923"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BNor BNor] == * direction: ** LEFT-TO-RIGHT * common name: ** butanal:NAD+ oxidoreductase (CoA-acyl...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] == * smiles: ** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BNor BNor] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))
 +
* inchi key:
 +
** InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N
 
* common name:
 
* common name:
−
** butanal:NAD+ oxidoreductase (CoA-acylating)
+
** hop-22(29)-ene
 +
* molecular weight:
 +
** 410.725   
 
* Synonym(s):
 
* Synonym(s):
 +
** diploptene
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[BUTANAL]][c] '''+''' 1.0 [[CO-A]][c] '''+''' 1.0 [[NAD]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] '''+''' 1.0 [[BUTYRYL-COA]][c]
+
* [[5.4.99.17-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 butan-1-al[c] '''+''' 1.0 coenzyme A[c] '''+''' 1.0 NAD+[c] '''=>''' 1.0 H+[c] '''+''' 1.0 NADH[c] '''+''' 1.0 butanoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2052]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=butanal:NAD+ oxidoreductase (CoA-acylating)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92155 92155]
−
{{#set: gene associated=Tiso_gene_2052}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.83200.html 83200]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4648 4648]
−
{{#set: reconstruction source=creinhardtii}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06310 C06310]
 +
{{#set: smiles=C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))}}
 +
{{#set: inchi key=InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N}}
 +
{{#set: common name=hop-22(29)-ene}}
 +
{{#set: molecular weight=410.725    }}
 +
{{#set: common name=diploptene}}
 +
{{#set: produced by=5.4.99.17-RXN}}

Revision as of 17:14, 10 January 2018

Metabolite HOP-2229-ENE

  • smiles:
    • C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))
  • inchi key:
    • InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N
  • common name:
    • hop-22(29)-ene
  • molecular weight:
    • 410.725
  • Synonym(s):
    • diploptene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15923&oldid=16875"