Difference between revisions of "RXN1G-1117"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * smiles: ** C[N+](CCOP([O-])([O-])=O)(C)C * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16631 RXN-16631] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16631 RXN-16631] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[3R-11Z-3-hydroxy-icos-11-enoyl-ACPs]][c] '''=>''' 1 [[2E-11Z-icosa-2-11-dienoyl-ACPs]][c] '''+''' 1 [[WATER]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 a (3R,11Z)-3-hydroxy-icos-11-enoyl-[acp][c] '''=>''' 1 an (2E,11Z)-icosa-2,11-dienoyl-[acp][c] '''+''' 1 H2O[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_6884]] | ||
| + | ** EXPERIMENTAL_ANNOTATION | ||
| + | ***AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-7663]], gondoate biosynthesis (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7663 PWY-7663] | ||
| + | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[experimental_annotation]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}} | |
| − | + | {{#set: ec number=EC-4.2.1.59}} | |
| − | + | {{#set: gene associated=Tiso_gene_6884}} | |
| − | + | {{#set: in pathway=PWY-7663}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | {{#set: reconstruction source=experimental_annotation}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:17, 10 January 2018
Contents
Reaction RXN-16631
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3R-11Z-3-hydroxy-icos-11-enoyl-ACPs[c] => 1 2E-11Z-icosa-2-11-dienoyl-ACPs[c] + 1 WATER[c]
- With common name(s):
- 1 a (3R,11Z)-3-hydroxy-icos-11-enoyl-[acp][c] => 1 an (2E,11Z)-icosa-2,11-dienoyl-[acp][c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_6884
- EXPERIMENTAL_ANNOTATION
- AUTOMATED-NAME-MATCH
- EXPERIMENTAL_ANNOTATION
Pathways
- PWY-7663, gondoate biosynthesis (anaerobic): PWY-7663
- 3 reactions found over 4 reactions in the full pathway
Reconstruction information
External links
"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.
