Difference between revisions of "Tiso gene 17498"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYAMPP PYAMPP] == * direction: ** LEFT-TO-RIGHT * common name: ** Pyridoxamine-5'-phosphate phospho...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYAMPP PYAMPP] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
+
 
* common name:
 
* common name:
** 6-cis-tridecenoyl-CoA
+
** Pyridoxamine-5'-phosphate phosphohydrolase
* molecular weight:
+
** 957.819   
+
 
* Synonym(s):
 
* Synonym(s):
** 6Z-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14771]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[PYRIDOXAMINE-5P]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[PYRIDOXAMINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 pyridoxamine 5'-phosphate[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 pyridoxamine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18054]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
+
{{#set: common name=Pyridoxamine-5'-phosphate phosphohydrolase}}
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Tiso_gene_18054}}
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=6-cis-tridecenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=957.819    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=6Z-tridecenoyl-CoA}}
+
{{#set: reconstruction source=creinhardtii}}
{{#set: consumed by=RXN-14771}}
+

Revision as of 17:18, 10 January 2018

Reaction PYAMPP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Pyridoxamine-5'-phosphate phosphohydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 pyridoxamine 5'-phosphate[c] => 1.0 phosphate[c] + 1.0 pyridoxamine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links