Difference between revisions of "Tiso gene 1474"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-905 RXN-905] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-_dehydrogenase **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == * smiles: ** CC(C)=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4)))) |
+ | * inchi key: | ||
+ | ** InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 5α-cholesta-7,24-dien-3β-ol |
− | + | * molecular weight: | |
− | * | + | ** 384.644 |
− | + | ||
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-26]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459827 5459827] | |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16290 16290] | |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05439 C05439] |
− | {{#set: | + | * HMDB : HMDB06842 |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N}} |
− | {{#set: | + | {{#set: common name=5α-cholesta-7,24-dien-3β-ol}} |
+ | {{#set: molecular weight=384.644 }} | ||
+ | {{#set: consumed by=RXN66-26}} |
Revision as of 18:18, 10 January 2018
Contents
Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL
- smiles:
- CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))
- inchi key:
- InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N
- common name:
- 5α-cholesta-7,24-dien-3β-ol
- molecular weight:
- 384.644
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.