Difference between revisions of "QUEUINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-mannuronates D-mannuronates] == * common name: ** D-mannuronate * Synonym(s): ** D-mannuronic...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-mannuronates D-mannuronates] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-mannuronate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** D-mannuronic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[MANNURONATE-REDUCTASE-RXN]] |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: common name=D-mannuronate}} |
| − | + | {{#set: common name=D-mannuronic acid}} | |
| − | {{#set: common name= | + | {{#set: consumed or produced by=MANNURONATE-REDUCTASE-RXN}} |
| − | + | ||
| − | + | ||
| − | {{#set: consumed or produced by= | + | |
Revision as of 17:18, 10 January 2018
Contents
Metabolite D-mannuronates
- common name:
- D-mannuronate
- Synonym(s):
- D-mannuronic acid
