Difference between revisions of "FORMYL-THF-GLU-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R06858 R06858] == * direction: ** LEFT-TO-RIGHT * common name: ** R611 * Synonym(s): == Reaction F...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R06858 R06858] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** R611 |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1.0 [[PHYTYL-PYROPHOSPHATE]][c] '''+''' 1.0 [[DIHYDROXYNAPHTHOATE]][c] '''=>''' 2.0 [[PROTON]][c] '''+''' 1.0 [[CARBON-DIOXIDE]][c] '''+''' 1.0 [[CPD-6947]][c] '''+''' 1.0 [[PPI]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1.0 phytyl diphosphate[c] '''+''' 1.0 2-carboxy-1,4-naphthoquinol[c] '''=>''' 2.0 H+[c] '''+''' 1.0 CO2[c] '''+''' 1.0 demethylphylloquinone[c] '''+''' 1.0 diphosphate[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * [[Tiso_gene_10317]] |
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[synechocystis]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=R611}} | |
− | + | {{#set: gene associated=Tiso_gene_10317}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=synechocystis}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:19, 10 January 2018
Contents
Reaction R06858
- direction:
- LEFT-TO-RIGHT
- common name:
- R611
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 PHYTYL-PYROPHOSPHATE[c] + 1.0 DIHYDROXYNAPHTHOATE[c] => 2.0 PROTON[c] + 1.0 CARBON-DIOXIDE[c] + 1.0 CPD-6947[c] + 1.0 PPI[c]
- With common name(s):
- 1.0 phytyl diphosphate[c] + 1.0 2-carboxy-1,4-naphthoquinol[c] => 2.0 H+[c] + 1.0 CO2[c] + 1.0 demethylphylloquinone[c] + 1.0 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.