Difference between revisions of "Sulfurylated-ThiI"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18460 == * left end position: ** 280 * transcription direction: ** POSITIVE * right end position: ** 2789 * centisome position: ** 9.293064...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] ==
+
== Gene Tiso_gene_18460 ==
−
* smiles:
+
* left end position:
−
** C[S+](CCC([N+])C(=O)[O-])C
+
** 280
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
+
** POSITIVE
−
* common name:
+
* right end position:
−
** S-methyl-L-methionine
+
** 2789
−
* molecular weight:
+
* centisome position:
−
** 164.242    
+
** 9.293064    
 
* Synonym(s):
 
* Synonym(s):
−
** S-methylmethionine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[MMUM-RXN]]
+
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-6799]]
 +
* [[PWY-7388]]
 +
* [[PWY-4381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=280}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2789}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252]
+
{{#set: centisome position=9.293064   }}
−
* BIGG : mmet
+
{{#set: reaction associated=MALONYL-COA-ACP-TRANSACYL-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6799|PWY-7388|PWY-4381}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172]
+
−
{{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}}
+
−
{{#set: common name=S-methyl-L-methionine}}
+
−
{{#set: molecular weight=164.242   }}
+
−
{{#set: common name=S-methylmethionine}}
+
−
{{#set: consumed by=MMUM-RXN}}
+

Revision as of 17:19, 10 January 2018

Gene Tiso_gene_18460

  • left end position:
    • 280
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2789
  • centisome position:
    • 9.293064
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Sulfurylated-ThiI&oldid=17227"