Difference between revisions of "RXN0-882"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15900 CPD-15900] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta21-3-hydroxyC40-ACPs cis-delta21-3-hydroxyC40-ACPs] == * common name: ** a cis-delta21...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15900 CPD-15900] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta21-3-hydroxyC40-ACPs cis-delta21-3-hydroxyC40-ACPs] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
* inchi key:
+
** InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J
+
 
* common name:
 
* common name:
** 2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA
+
** a cis-delta21-3-hydroxyC40:1-[acp]
* molecular weight:
+
** 903.641   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-287]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-15013]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis-delta21-3-hydroxyC40:1-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551544 72551544]
+
{{#set: produced by=RXN1G-287}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76527 76527]
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J}}
+
{{#set: common name=2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA}}
+
{{#set: molecular weight=903.641    }}
+
{{#set: consumed or produced by=RXN-15013}}
+

Revision as of 17:19, 10 January 2018

Metabolite cis-delta21-3-hydroxyC40-ACPs

  • common name:
    • a cis-delta21-3-hydroxyC40:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta21-3-hydroxyC40:1-[acp" cannot be used as a page name in this wiki.