Difference between revisions of "RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40."

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-ferredoxins Reduced-ferredoxins] == * common name: ** a reduced ferredoxin [iron-sulfur...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-ferredoxins Reduced-ferredoxins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] ==
 +
* smiles:
 +
** C[S+](CCC([N+])C(=O)[O-])C
 +
* inchi key:
 +
** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
 
* common name:
 
* common name:
−
** a reduced ferredoxin [iron-sulfur] cluster
+
** S-methyl-L-methionine
 +
* molecular weight:
 +
** 164.242   
 
* Synonym(s):
 
* Synonym(s):
−
** a reduced ferredoxin
+
** S-methylmethionine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
+
* [[MMUM-RXN]]
−
* [[RXN-7979]]
+
−
* [[1.3.7.4-RXN]]
+
−
* [[FNorh]]
+
−
* [[RXN-7903]]
+
−
* [[RXN-7741]]
+
−
* [[RXN-8389]]
+
−
* [[RXN0-882]]
+
−
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
+
−
* [[RXN-13193]]
+
−
* [[RXN-5061]]
+
−
* [[RXN-7978]]
+
−
* [[1.3.7.3-RXN]]
+
−
* [[RXN0-884]]
+
−
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
+
−
* [[1.18.1.2-RXN]]
+
−
* [[ISPH2-RXN]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12878]]
 
−
* [[RXN-15468]]
 
−
* [[RXN-17897]]
 
−
* [[GCLDH]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[HYDROG-RXN]]
 
 
== External links  ==
 
== External links  ==
−
{{#set: common name=a reduced ferredoxin [iron-sulfur] cluster}}
+
* PUBCHEM:
−
{{#set: common name=a reduced ferredoxin}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638]
−
{{#set: consumed by=FERREDOXIN--NITRITE-REDUCTASE-RXN|RXN-7979|1.3.7.4-RXN|FNorh|RXN-7903|RXN-7741|RXN-8389|RXN0-882|SULFITE-REDUCTASE-FERREDOXIN-RXN|RXN-13193|RXN-5061|RXN-7978|1.3.7.3-RXN|RXN0-884|GLUTAMATE-SYNTHASE-FERREDOXIN-RXN|1.18.1.2-RXN|ISPH2-RXN}}
+
* CHEBI:
−
{{#set: produced by=RXN-12878|RXN-15468|RXN-17897|GCLDH}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252]
−
{{#set: consumed or produced by=HYDROG-RXN}}
+
* BIGG : mmet
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172]
 +
{{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}}
 +
{{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}}
 +
{{#set: common name=S-methyl-L-methionine}}
 +
{{#set: molecular weight=164.242    }}
 +
{{#set: common name=S-methylmethionine}}
 +
{{#set: consumed by=MMUM-RXN}}

Revision as of 17:19, 10 January 2018

Metabolite CPD-397

  • smiles:
    • C[S+](CCC([N+])C(=O)[O-])C
  • inchi key:
    • InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
  • common name:
    • S-methyl-L-methionine
  • molecular weight:
    • 164.242
  • Synonym(s):
    • S-methylmethionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[S+](CCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.&oldid=17278"