Difference between revisions of "Tiso gene 18785"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D3-cis-D9-hexadecenoyl-ACPs Trans-D3-cis-D9-hexadecenoyl-ACPs] == * common name: ** a tra...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO * inchi key: ** InChIKey=U...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == |
| + | * smiles: | ||
| + | ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO | ||
| + | * inchi key: | ||
| + | ** InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-oleoylglycerol |
| + | * molecular weight: | ||
| + | ** 356.545 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-mono-C18:1 | ||
| + | ** 2-monoolein | ||
| + | ** 2-monooleoylglycerol | ||
| + | ** 2-glyceryl monooleate | ||
| + | ** 1,3-dihydroxypropan-2-yl oleate | ||
| + | ** 2-(9Z)-octadecenoylglycerol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15088]] |
| + | * [[RXN-15091]] | ||
| + | * [[RXN-15090]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIPID_MAPS : LMGL01010024 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5319879 5319879] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73990 73990] | ||
| + | * METABOLIGHTS : MTBLC73990 | ||
| + | * HMDB : HMDB11537 | ||
| + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO}} | ||
| + | {{#set: inchi key=InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N}} | ||
| + | {{#set: common name=2-oleoylglycerol}} | ||
| + | {{#set: molecular weight=356.545 }} | ||
| + | {{#set: common name=2-mono-C18:1|2-monoolein|2-monooleoylglycerol|2-glyceryl monooleate|1,3-dihydroxypropan-2-yl oleate|2-(9Z)-octadecenoylglycerol}} | ||
| + | {{#set: consumed by=RXN-15088|RXN-15091|RXN-15090}} | ||
Revision as of 17:20, 10 January 2018
Contents
Metabolite CPD0-1812
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO
- inchi key:
- InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N
- common name:
- 2-oleoylglycerol
- molecular weight:
- 356.545
- Synonym(s):
- 2-mono-C18:1
- 2-monoolein
- 2-monooleoylglycerol
- 2-glyceryl monooleate
- 1,3-dihydroxypropan-2-yl oleate
- 2-(9Z)-octadecenoylglycerol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
