|
|
Line 1: |
Line 1: |
− | [[Category:Metabolite]] | + | [[Category:Gene]] |
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE] == | + | == Gene Tiso_gene_12326 == |
− | * smiles:
| + | |
− | ** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C(N)=C(C(=O)NC(C([O-])=O)CC([O-])=O)N=C1))O2)
| + | |
− | * inchi key:
| + | |
− | ** InChIKey=NAQGHJTUZRHGAC-LBGUGVGYSA-J
| + | |
− | * common name:
| + | |
− | ** 5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole
| + | |
− | * molecular weight:
| + | |
− | ** 450.255
| + | |
| * Synonym(s): | | * Synonym(s): |
− | ** (S)-2-[5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamido]succinate
| |
− | ** 1-(5-phosphoribosyl)-4-(N-succino-carboxamide)-5-aminoimidazole
| |
− | ** 5'-P-ribosyl-4-(N-succinocarboxamide)-5-aminoimidazole
| |
− | ** 5'-p-Ribosyl-4-(N-succinocarboxamide)-5-amino imidazole
| |
− | ** 1-(5'-phosphoribosyl)-4-(N-succino-carboxamide)-5-aminoimidazole
| |
− | ** SAICAR
| |
| | | |
− | == Reaction(s) known to consume the compound == | + | == Reactions associated == |
− | == Reaction(s) known to produce the compound ==
| + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] |
− | * [[SAICARSYN-RXN]] | + | ** [[pantograph]]-[[esiliculosus]] |
− | == Reaction(s) of unknown directionality ==
| + | * [[RXN0-1321]] |
− | * [[AIAL]] | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[AICARSYN-RXN]] | + | == Pathways associated == |
| + | * [[PWY-6700]] |
| == External links == | | == External links == |
− | * BIGG : 25aics
| + | {{#set: reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN|RXN0-1321}} |
− | * PUBCHEM:
| + | {{#set: pathway associated=PWY-6700}} |
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266647 45266647]
| + | |
− | * HMDB : HMDB00797
| + | |
− | * LIGAND-CPD:
| + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?C04823 C04823]
| + | |
− | * CHEBI:
| + | |
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58443 58443]
| + | |
− | * METABOLIGHTS : MTBLC58443
| + | |
− | {{#set: smiles=C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C(N)=C(C(=O)NC(C([O-])=O)CC([O-])=O)N=C1))O2)}} | + | |
− | {{#set: inchi key=InChIKey=NAQGHJTUZRHGAC-LBGUGVGYSA-J}}
| + | |
− | {{#set: common name=5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole}}
| + | |
− | {{#set: molecular weight=450.255 }}
| + | |
− | {{#set: common name=(S)-2-[5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamido]succinate|1-(5-phosphoribosyl)-4-(N-succino-carboxamide)-5-aminoimidazole|5'-P-ribosyl-4-(N-succinocarboxamide)-5-aminoimidazole|5'-p-Ribosyl-4-(N-succinocarboxamide)-5-amino imidazole|1-(5'-phosphoribosyl)-4-(N-succino-carboxamide)-5-aminoimidazole|SAICAR}}
| + | |
− | {{#set: produced by=SAICARSYN-RXN}} | + | |
− | {{#set: consumed or produced by=AIAL|AICARSYN-RXN}}
| + | |