Difference between revisions of "Tiso gene 199"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14283 CPD-14283] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)CO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L |
* common name: | * common name: | ||
− | ** | + | ** 1-oleoyl-2-lyso-glycerone phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 432.493 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1-oleoyl-2-lyso-dihydroxyacetone phosphate |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15046]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-15044]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289257 86289257] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77492 77492] |
− | {{#set: smiles= | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L}} |
− | {{#set: common name= | + | {{#set: common name=1-oleoyl-2-lyso-glycerone phosphate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=432.493 }} |
− | {{#set: common name= | + | {{#set: common name=1-oleoyl-2-lyso-dihydroxyacetone phosphate}} |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-15046}} |
− | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-15044}} |
Revision as of 18:24, 10 January 2018
Contents
Metabolite CPD-15924
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O
- inchi key:
- InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L
- common name:
- 1-oleoyl-2-lyso-glycerone phosphate
- molecular weight:
- 432.493
- Synonym(s):
- 1-oleoyl-2-lyso-dihydroxyacetone phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O" cannot be used as a page name in this wiki.