Difference between revisions of "Tiso gene 13367"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-]...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3173 == * Synonym(s): == Reactions associated == * THIAZOLSYN3-RXN ** pantograph-esiliculosus == Pathways associated == * PW...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] ==
+
== Gene Tiso_gene_3173 ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
+
* common name:
+
** ω-carboxy-(9Z)-octadec-9-enoyl-CoA
+
* molecular weight:
+
** 1056.928   
+
 
* Synonym(s):
 
* Synonym(s):
** 18-carboxyl oleoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[THIAZOLSYN3-RXN]]
* [[RXN-16418]]
+
** [[pantograph]]-[[esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6897]]
 +
* [[PWY-7356]]
 +
* [[PWY-7357]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=THIAZOLSYN3-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820430 91820430]
+
{{#set: pathway associated=PWY-6897|PWY-7356|PWY-7357}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I}}
+
{{#set: common name=ω-carboxy-(9Z)-octadec-9-enoyl-CoA}}
+
{{#set: molecular weight=1056.928    }}
+
{{#set: common name=18-carboxyl oleoyl-CoA}}
+
{{#set: produced by=RXN-16418}}
+

Revision as of 17:25, 10 January 2018

Gene Tiso_gene_3173

  • Synonym(s):

Reactions associated

Pathways associated

External links