Difference between revisions of "CPD-9007"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UTUP UTUP] == * direction: ** LEFT-TO-RIGHT * common name: ** UTP:uridine 5'-phosphotransferase * S...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UTUP UTUP] ==
* smiles:
+
* direction:
** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
+
 
* common name:
 
* common name:
** betanidin
+
** UTP:uridine 5'-phosphotransferase
* molecular weight:
+
** 386.317   
+
 
* Synonym(s):
 
* Synonym(s):
** betanidin radical
 
** 2,6-Pyridinedicarboxylic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-8635]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[URIDINE]][c] '''+''' 1.0 [[UTP]][c] '''=>''' 1.0 [[UMP]][c] '''+''' 1.0 [[UDP]][c] '''+''' 1.0 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 uridine[c] '''+''' 1.0 UTP[c] '''=>''' 1.0 UMP[c] '''+''' 1.0 UDP[c] '''+''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_20134]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_14474]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB00217
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=UTP:uridine 5'-phosphotransferase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506]
+
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
* CHEBI:
+
{{#set: in pathway=}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079]
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539]
+
{{#set: reconstruction source=creinhardtii}}
* HMDB : HMDB29407
+
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
{{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}}
+
{{#set: common name=betanidin}}
+
{{#set: molecular weight=386.317    }}
+
{{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}}
+
{{#set: consumed by=RXN-8635}}
+

Revision as of 18:25, 10 January 2018

Reaction UTUP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • UTP:uridine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 uridine[c] + 1.0 UTP[c] => 1.0 UMP[c] + 1.0 UDP[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links