Difference between revisions of "CPD-10813"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-469 RXN1G-469] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxobehenoyl-[acyl-carrier...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SEDOHEPTULOSE-1-7-P2 D-SEDOHEPTULOSE-1-7-P2] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(O)C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SEDOHEPTULOSE-1-7-P2 D-SEDOHEPTULOSE-1-7-P2] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])[O-])C(O)C(O)C(O)C(O)C(COP([O-])(=O)[O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=OKHXOUGRECCASI-SHUUEZRQSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** D-sedoheptulose-1,7-bisphosphate |
− | * | + | * molecular weight: |
− | + | ** 366.112 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** sedoheptulose 1,7-bisphosphate | ||
+ | ** D-sedoheptulose-1,7-diphosphate | ||
+ | ** D-sedoheptulose-1,7-P2 | ||
+ | ** SBP | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-6541]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[SEDOBISALDOL-RXN]] | |
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00447 C00447] | |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58335 58335] | |
− | + | * METABOLIGHTS : MTBLC58335 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878435 46878435] |
− | {{#set: | + | * HMDB : HMDB60274 |
− | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(O)C(O)C(COP([O-])(=O)[O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OKHXOUGRECCASI-SHUUEZRQSA-J}} |
− | {{#set: | + | {{#set: common name=D-sedoheptulose-1,7-bisphosphate}} |
− | {{#set: | + | {{#set: molecular weight=366.112 }} |
+ | {{#set: common name=sedoheptulose 1,7-bisphosphate|D-sedoheptulose-1,7-diphosphate|D-sedoheptulose-1,7-P2|SBP}} | ||
+ | {{#set: consumed by=SEDOHEPTULOSE-BISPHOSPHATASE-RXN}} | ||
+ | {{#set: produced by=RXN0-6541}} | ||
+ | {{#set: consumed or produced by=SEDOBISALDOL-RXN}} |
Revision as of 17:25, 10 January 2018
Contents
Metabolite D-SEDOHEPTULOSE-1-7-P2
- smiles:
- C(OP(=O)([O-])[O-])C(O)C(O)C(O)C(O)C(COP([O-])(=O)[O-])=O
- inchi key:
- InChIKey=OKHXOUGRECCASI-SHUUEZRQSA-J
- common name:
- D-sedoheptulose-1,7-bisphosphate
- molecular weight:
- 366.112
- Synonym(s):
- sedoheptulose 1,7-bisphosphate
- D-sedoheptulose-1,7-diphosphate
- D-sedoheptulose-1,7-P2
- SBP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C(O)C(O)C(O)C(O)C(COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.