Difference between revisions of "TransportSeed F-"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5173 == * left end position: ** 9232 * transcription direction: ** POSITIVE * right end position: ** 11125 * centisome position: ** 66.8162...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
+
== Gene Tiso_gene_5173 ==
−
* smiles:
+
* left end position:
−
** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
+
** 9232
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-hydroxy-dATP
+
** 11125
−
* molecular weight:
+
* centisome position:
−
** 503.152    
+
** 66.81624    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
 
−
** 2'-deoxyisoguanosine triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-10642]]
−
* [[RXN-14290]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[UROGENDECARBOX-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[HEMESYN2-PWY]]
 +
* [[PWY0-1415]]
 +
* [[HEME-BIOSYNTHESIS-II]]
 +
* [[PWY-7766]]
 +
* [[CHLOROPHYLL-SYN]]
 +
* [[PWY-7159]]
 +
* [[PWY-5531]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=9232}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=11125}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
+
{{#set: centisome position=66.81624   }}
−
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}}
+
{{#set: reaction associated=RXN-10642|UROGENDECARBOX-RXN}}
−
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
+
{{#set: pathway associated=HEMESYN2-PWY|PWY0-1415|HEME-BIOSYNTHESIS-II|PWY-7766|CHLOROPHYLL-SYN|PWY-7159|PWY-5531}}
−
{{#set: common name=2-hydroxy-dATP}}
+
−
{{#set: molecular weight=503.152   }}
+
−
{{#set: common name=2-hydroxy-2'-deoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
+
−
{{#set: produced by=RXN-14290}}
+

Revision as of 17:25, 10 January 2018

Gene Tiso_gene_5173

  • left end position:
    • 9232
  • transcription direction:
    • POSITIVE
  • right end position:
    • 11125
  • centisome position:
    • 66.81624
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TransportSeed_F-&oldid=17717"