Difference between revisions of "Tiso gene 20269"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17621 CPD-17621] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17621 CPD-17621] == |
* smiles: | * smiles: | ||
| − | ** CC(C(C(=O)[O-]) | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ROZGNNDROQHXPF-BBECNAHFSA-J |
* common name: | * common name: | ||
| − | ** | + | ** 16-hydroxypalmitoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1017.914 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ω-hydroxy-hexadecanoyl-coenzyme A |
| + | ** ω-hydroxypalmitoyl-CoA | ||
| + | ** 16-hydroxy-hexadecanoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16389]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86583440 86583440] |
| − | * | + | * CHEBI: |
| − | {{#set: smiles=CC(C(C(=O)[O-]) | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84207 84207] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=ROZGNNDROQHXPF-BBECNAHFSA-J}} |
| − | {{#set: molecular weight= | + | {{#set: common name=16-hydroxypalmitoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: molecular weight=1017.914 }} |
| − | + | {{#set: common name=ω-hydroxy-hexadecanoyl-coenzyme A|ω-hydroxypalmitoyl-CoA|16-hydroxy-hexadecanoyl-CoA}} | |
| − | {{#set: produced by= | + | {{#set: produced by=RXN-16389}} |
| − | + | ||
Revision as of 17:27, 10 January 2018
Contents
Metabolite CPD-17621
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=ROZGNNDROQHXPF-BBECNAHFSA-J
- common name:
- 16-hydroxypalmitoyl-CoA
- molecular weight:
- 1017.914
- Synonym(s):
- ω-hydroxy-hexadecanoyl-coenzyme A
- ω-hydroxypalmitoyl-CoA
- 16-hydroxy-hexadecanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
