Difference between revisions of "CPD-10825"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOADIPATE-ENOL-LACTONE 3-OXOADIPATE-ENOL-LACTONE] == * smiles: ** C(=O)(CC1(=CCC(=O)O1))[O-]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12581 RXN-12581] == * direction: ** LEFT-TO-RIGHT * common name: ** dehydrogenase_reductase_sdr...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOADIPATE-ENOL-LACTONE 3-OXOADIPATE-ENOL-LACTONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12581 RXN-12581] ==
* smiles:
+
* direction:
** C(=O)(CC1(=CCC(=O)O1))[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ZPEHSARSWGDCEX-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** (4,5-dihydro-5-oxofuran-2-yl)-acetate
+
** dehydrogenase_reductase_sdr_family_member_on_chromosome_x-like
* molecular weight:
+
* ec number:
** 141.103   
+
** [http://enzyme.expasy.org/EC/1.1.1.105 EC-1.1.1.105]
 
* Synonym(s):
 
* Synonym(s):
** 3-oxoadipate enol lactone
 
** β-ketoadipate-enol-lactone
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[3-OXOADIPATE-ENOL-LACTONASE-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CRPB-all-trans-Retinol]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CRPB-all-trans-Retinal]][c] '''+''' 1 [[NADH]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 an all-trans retinol-[cellular-retinol-binding-protein][c] '''=>''' 1 H+[c] '''+''' 1 an all-trans retinal-[cellular-retinol-binding-protein][c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_17086]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6872]], retinoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6872 PWY-6872]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615198 23615198]
+
{{#set: common name=dehydrogenase_reductase_sdr_family_member_on_chromosome_x-like}}
* CHEMSPIDER:
+
{{#set: ec number=EC-1.1.1.105}}
** [http://www.chemspider.com/Chemical-Structure.19951100.html 19951100]
+
{{#set: gene associated=Tiso_gene_17086}}
* CHEBI:
+
{{#set: in pathway=PWY-6872}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58425 58425]
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.genome.jp/dbget-bin/www_bget?C03586 C03586]
+
{{#set: reconstruction source=in-silico_annotation}}
{{#set: smiles=C(=O)(CC1(=CCC(=O)O1))[O-]}}
+
{{#set: inchi key=InChIKey=ZPEHSARSWGDCEX-UHFFFAOYSA-M}}
+
{{#set: common name=(4,5-dihydro-5-oxofuran-2-yl)-acetate}}
+
{{#set: molecular weight=141.103    }}
+
{{#set: common name=3-oxoadipate enol lactone|β-ketoadipate-enol-lactone}}
+
{{#set: consumed by=3-OXOADIPATE-ENOL-LACTONASE-RXN}}
+

Revision as of 18:28, 10 January 2018

Reaction RXN-12581

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dehydrogenase_reductase_sdr_family_member_on_chromosome_x-like
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 an all-trans retinol-[cellular-retinol-binding-protein][c] => 1 H+[c] + 1 an all-trans retinal-[cellular-retinol-binding-protein][c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6872, retinoate biosynthesis I: PWY-6872
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links