Difference between revisions of "Tiso gene 8160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12171 == * left end position: ** 1674 * transcription direction: ** POSITIVE * right end position: ** 6922 * centisome position: ** 23.1279...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] == * smiles: ** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_12171 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] ==
−
* left end position:
+
* smiles:
−
** 1674
+
** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N
−
* right end position:
+
* common name:
−
** 6922
+
** 9'-cis-neoxanthin
−
* centisome position:
+
* molecular weight:
−
** 23.127935    
+
** 600.88    
 
* Synonym(s):
 
* Synonym(s):
 +
** 9cNeox
 +
** 9c-neoxanthin
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[TYROSINE--TRNA-LIGASE-RXN]]
+
* [[RXN-698]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** experimental_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[TRNA-CHARGING-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1674}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282217 5282217]
−
{{#set: right end position=6922}}
+
* CHEMSPIDER:
−
{{#set: centisome position=23.127935   }}
+
** [http://www.chemspider.com/Chemical-Structure.10392237.html 10392237]
−
{{#set: reaction associated=TYROSINE--TRNA-LIGASE-RXN}}
+
* CHEBI:
−
{{#set: pathway associated=TRNA-CHARGING-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35306 35306]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C13431 C13431]
 +
{{#set: smiles=CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)}}
 +
{{#set: inchi key=InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N}}
 +
{{#set: common name=9'-cis-neoxanthin}}
 +
{{#set: molecular weight=600.88   }}
 +
{{#set: common name=9cNeox|9c-neoxanthin}}
 +
{{#set: consumed by=RXN-698}}

Revision as of 17:29, 10 January 2018

Metabolite CPD-7424

  • smiles:
    • CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)
  • inchi key:
    • InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N
  • common name:
    • 9'-cis-neoxanthin
  • molecular weight:
    • 600.88
  • Synonym(s):
    • 9cNeox
    • 9c-neoxanthin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8160&oldid=18014"