Difference between revisions of "RXN-16619"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17931 CPD-17931] == * common name: ** a peptidoglycan with (L-alanyl-γ-D-glutamyl-mes...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] == * smiles: ** C(C1(C(C(C(C(O1)OP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] == |
| + | * smiles: | ||
| + | ** C(C1(C(C(C(C(O1)OP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))(=O)[O-])(=O)[O-])O)O)O))O | ||
| + | * inchi key: | ||
| + | ** InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** ADP-α-D-glucose |
| + | * molecular weight: | ||
| + | ** 587.33 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** adenosine diphosphate glucose | ||
| + | ** ADP-glucose | ||
| + | ** ADP-D-glucose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.4.1.213-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 2140-58-1 |
| − | {{#set: consumed by= | + | * METABOLIGHTS : MTBLC57498 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=42609821 42609821] | ||
| + | * HMDB : HMDB06557 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00498 C00498] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57498 57498] | ||
| + | * BIGG : adpglc | ||
| + | {{#set: smiles=C(C1(C(C(C(C(O1)OP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))(=O)[O-])(=O)[O-])O)O)O))O}} | ||
| + | {{#set: inchi key=InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L}} | ||
| + | {{#set: common name=ADP-α-D-glucose}} | ||
| + | {{#set: molecular weight=587.33 }} | ||
| + | {{#set: common name=adenosine diphosphate glucose|ADP-glucose|ADP-D-glucose}} | ||
| + | {{#set: consumed or produced by=2.4.1.213-RXN}} | ||
Revision as of 17:29, 10 January 2018
Contents
Metabolite ADP-D-GLUCOSE
- smiles:
- C(C1(C(C(C(C(O1)OP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))(=O)[O-])(=O)[O-])O)O)O))O
- inchi key:
- InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L
- common name:
- ADP-α-D-glucose
- molecular weight:
- 587.33
- Synonym(s):
- adenosine diphosphate glucose
- ADP-glucose
- ADP-D-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2140-58-1
- METABOLIGHTS : MTBLC57498
- PUBCHEM:
- HMDB : HMDB06557
- LIGAND-CPD:
- CHEBI:
- BIGG : adpglc
"C(C1(C(C(C(C(O1)OP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))(=O)[O-])(=O)[O-])O)O)O))O" cannot be used as a page name in this wiki.
