Difference between revisions of "RXN-10695"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FA Odd-Straight-Chain-234-Sat-FA] == * common name: ** an odd number...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FA Odd-Straight-Chain-234-Sat-FA] ==
* smiles:
+
** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
+
* inchi key:
+
** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3-O-methylkaempferol
+
** an odd numbered straight chain 2,3,4-saturated fatty acid
* molecular weight:
+
** 300.267   
+
 
* Synonym(s):
 
* Synonym(s):
** kaempferol 3-methyl ether
 
** 3-Methoxyapigenin
 
** isokaempferide
 
** 3-methylkaempferol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-477]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13935]]
+
* [[RXN66-476]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an odd numbered straight chain 2,3,4-saturated fatty acid}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862]
+
{{#set: consumed by=RXN66-477}}
* CHEBI:
+
{{#set: produced by=RXN66-476}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902]
+
{{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}}
+
{{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}}
+
{{#set: common name=3-O-methylkaempferol}}
+
{{#set: molecular weight=300.267    }}
+
{{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}}
+
{{#set: produced by=RXN-13935}}
+

Revision as of 18:29, 10 January 2018

Metabolite Odd-Straight-Chain-234-Sat-FA

  • common name:
    • an odd numbered straight chain 2,3,4-saturated fatty acid
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links