Difference between revisions of "UDP-GLUCURONATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] == * smiles: ** CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_6376 == * left end position: ** 2643 * transcription direction: ** POSITIVE * right end position: ** 7383 * centisome position: ** 21.55791...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] ==
+
== Gene Tiso_gene_6376 ==
* smiles:
+
* left end position:
** CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2643
* inchi key:
+
* transcription direction:
** InChIKey=SCDXBWNPJAGEEK-KBOAXVDLSA-J
+
** POSITIVE
* common name:
+
* right end position:
** (S)-3-hydroxy-(11Z)-octadecenoyl-CoA
+
** 7383
* molecular weight:
+
* centisome position:
** 1043.952    
+
** 21.557913    
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-18:1-Δ11-CoA
 
** (S)-3-hydroxy-11-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17786]]
+
* [[2.1.1.77-RXN]]
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=2643}}
{{#set: inchi key=InChIKey=SCDXBWNPJAGEEK-KBOAXVDLSA-J}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: common name=(S)-3-hydroxy-(11Z)-octadecenoyl-CoA}}
+
{{#set: right end position=7383}}
{{#set: molecular weight=1043.952   }}
+
{{#set: centisome position=21.557913   }}
{{#set: common name=(S)-3-hydroxy-18:1-Δ11-CoA|(S)-3-hydroxy-11-cis-octadecenoyl-CoA}}
+
{{#set: reaction associated=2.1.1.77-RXN}}
{{#set: consumed by=RXN-17786}}
+

Revision as of 18:30, 10 January 2018

Gene Tiso_gene_6376

  • left end position:
    • 2643
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7383
  • centisome position:
    • 21.557913
  • Synonym(s):

Reactions associated

Pathways associated

External links