Difference between revisions of "Tiso gene 13793"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4230 RXN-4230] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] == * smiles: ** C([N+])C2(C1(C(=O)NC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] == |
− | * | + | * smiles: |
− | ** | + | ** C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O |
+ | * common name: | ||
+ | ** preQ1 | ||
+ | * molecular weight: | ||
+ | ** 180.189 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 7-aminomethyl-7-deazaguanine | ||
+ | ** 7-aminomethyl-7-carbaguanine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN0-1321]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202264 25202264] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58703 58703] |
− | {{#set: | + | {{#set: smiles=C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O}} |
− | {{#set: | + | {{#set: common name=preQ1}} |
− | {{#set: | + | {{#set: molecular weight=180.189 }} |
− | {{#set: | + | {{#set: common name=7-aminomethyl-7-deazaguanine|7-aminomethyl-7-carbaguanine}} |
+ | {{#set: consumed by=RXN0-1321}} |
Revision as of 17:30, 10 January 2018
Contents
Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE
- smiles:
- C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))
- inchi key:
- InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O
- common name:
- preQ1
- molecular weight:
- 180.189
- Synonym(s):
- 7-aminomethyl-7-deazaguanine
- 7-aminomethyl-7-carbaguanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))" cannot be used as a page name in this wiki.