Difference between revisions of "RXN-8988"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-terminal-L-threonine Protein-N-terminal-L-threonine] == * common name: ** an N-termin...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == * smiles: ** C([N...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == |
| + | * smiles: | ||
| + | ** C([N+])COP([O-])(=O)OCC(O)CO[R] | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-alkyl-sn-glycero-3-phosphoethanolamine |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine |
| + | ** 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine | ||
| + | ** 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[LPLPS1AGPE180]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04476 C04476] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: produced by= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18244 18244] |
| + | {{#set: smiles=C([N+])COP([O-])(=O)OCC(O)CO[R]}} | ||
| + | {{#set: common name=1-alkyl-sn-glycero-3-phosphoethanolamine}} | ||
| + | {{#set: common name=1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine|1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine|1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine}} | ||
| + | {{#set: produced by=LPLPS1AGPE180}} | ||
Revision as of 18:31, 10 January 2018
Contents
Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE
- smiles:
- C([N+])COP([O-])(=O)OCC(O)CO[R]
- common name:
- 1-alkyl-sn-glycero-3-phosphoethanolamine
- Synonym(s):
- 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
- 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
- 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])COP([O-])(=O)OCC(O)CO[R" cannot be used as a page name in this wiki.
