Difference between revisions of "Oligosaccharides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_13793 == * Synonym(s): == Reactions associated == * GLUTCYSLIG-RXN ** in-silico_annotation ***ec-number ** pantograph-esiliculos...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_13793 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[GLUTCYSLIG-RXN]] | |
| − | * [[ | + | ** in-silico_annotation |
| − | == | + | ***ec-number |
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-6840]] | ||
| + | * [[PWY-7255]] | ||
| + | * [[GLUTATHIONESYN-PWY]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=GLUTCYSLIG-RXN}} | |
| − | + | {{#set: pathway associated=PWY-6840|PWY-7255|GLUTATHIONESYN-PWY}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 17:31, 10 January 2018
Gene Tiso_gene_13793
- Synonym(s):
Reactions associated
- GLUTCYSLIG-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
