Difference between revisions of "Tiso gene 4160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_2226 == * left end position: ** 7421 * transcription direction: ** NEGATIVE * right end position: ** 11435 * centisome position: ** 36.9774...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] == * smiles: ** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_2226 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] ==
−
* left end position:
+
* smiles:
−
** 7421
+
** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K
−
* right end position:
+
* common name:
−
** 11435
+
** tetrahydromethanopterin
−
* centisome position:
+
* molecular weight:
−
** 36.97743    
+
** 773.666    
 
* Synonym(s):
 
* Synonym(s):
 +
** THMPT
 +
** 5,6,7,8-tetrahydromethanopterin
 +
** H4MPT
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15556]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-15635]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7421}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791993 49791993]
−
{{#set: right end position=11435}}
+
* CHEBI:
−
{{#set: centisome position=36.97743   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58103 58103]
−
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-7511}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01217 C01217]
 +
* HMDB : HMDB60403
 +
{{#set: smiles=CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)}}
 +
{{#set: inchi key=InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K}}
 +
{{#set: common name=tetrahydromethanopterin}}
 +
{{#set: molecular weight=773.666   }}
 +
{{#set: common name=THMPT|5,6,7,8-tetrahydromethanopterin|H4MPT}}
 +
{{#set: produced by=RXN-15635}}

Revision as of 17:31, 10 January 2018

Metabolite THMPT

  • smiles:
    • CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)
  • inchi key:
    • InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K
  • common name:
    • tetrahydromethanopterin
  • molecular weight:
    • 773.666
  • Synonym(s):
    • THMPT
    • 5,6,7,8-tetrahydromethanopterin
    • H4MPT

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4160&oldid=18252"