Difference between revisions of "GLUTAMATE-SYNTHASE-FERREDOXIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == * smiles: ** C(O)C1(C(O)C(O)C(O)O1) * inchi key: ** InChIKey=HMFHBZSHGG...")
 
(Created page with "Category:Gene == Gene Tiso_gene_4615 == * left end position: ** 12189 * transcription direction: ** NEGATIVE * right end position: ** 14665 * centisome position: ** 83.087...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] ==
+
== Gene Tiso_gene_4615 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(C(O)C(O)C(O)O1)
+
** 12189
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** α-L-arabinofuranose
+
** 14665
−
* molecular weight:
+
* centisome position:
−
** 150.131    
+
** 83.08794    
 
* Synonym(s):
 
* Synonym(s):
−
** α-L-arabinose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[ALPHAGALACTOSID-RXN]]
−
* [[3.2.1.55-RXN]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[RXN-11501]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[RXN-11502]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[RXN-12088]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN-17754]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN-17830]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6527]]
 +
* [[PWY0-1301]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03142
+
{{#set: left end position=12189}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445935 445935]
+
{{#set: right end position=14665}}
−
* CHEMSPIDER:
+
{{#set: centisome position=83.08794   }}
−
** [http://www.chemspider.com/Chemical-Structure.393416.html 393416]
+
{{#set: reaction associated=ALPHAGALACTOSID-RXN|RXN-11501|RXN-11502|RXN-12088|RXN-17754|RXN-17830}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-6527|PWY0-1301}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28772 28772]
+
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)O1)}}
+
−
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N}}
+
−
{{#set: common name=α-L-arabinofuranose}}
+
−
{{#set: molecular weight=150.131   }}
+
−
{{#set: common name=α-L-arabinose}}
+
−
{{#set: produced by=3.2.1.55-RXN}}
+

Revision as of 18:32, 10 January 2018

Gene Tiso_gene_4615

  • left end position:
    • 12189
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 14665
  • centisome position:
    • 83.08794
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLUTAMATE-SYNTHASE-FERREDOXIN-RXN&oldid=18266"