Difference between revisions of "RXN-6903"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=APAPT APAPT] == * direction: ** LEFT-TO-RIGHT * common name: ** S-adenosylmethioninamine:putrescine...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=APAPT APAPT] ==
* smiles:
+
* direction:
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
+
 
* common name:
 
* common name:
** gibberellin A8
+
** S-adenosylmethioninamine:putrescine 3-aminopropyltransferase
* molecular weight:
+
** 363.386   
+
 
* Synonym(s):
 
* Synonym(s):
** GA8
 
** 2β-hydroxygibberellin 1
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-115]]
+
** 1.0 [[PUTRESCINE]][c] '''+''' 1.0 [[S-ADENOSYLMETHIONINAMINE]][c] '''=>''' 1.0 [[SPERMIDINE]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[5-METHYLTHIOADENOSINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 putrescine[c] '''+''' 1.0 S-adenosyl 3-(methylthio)propylamine[c] '''=>''' 1.0 spermidine[c] '''+''' 1.0 H+[c] '''+''' 1.0 S-methyl-5'-thioadenosine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_17803]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203521 25203521]
+
{{#set: common name=S-adenosylmethioninamine:putrescine 3-aminopropyltransferase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_17803}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28861 28861]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C03579 C03579]
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: reconstruction source=creinhardtii}}
{{#set: inchi key=InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M}}
+
{{#set: common name=gibberellin A8}}
+
{{#set: molecular weight=363.386    }}
+
{{#set: common name=GA8|2β-hydroxygibberellin 1}}
+
{{#set: produced by=RXN-115}}
+

Revision as of 17:32, 10 January 2018

Reaction APAPT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • S-adenosylmethioninamine:putrescine 3-aminopropyltransferase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links