Difference between revisions of "Tiso gene 9531"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] == * smiles: ** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diphosphate_re...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J
+
 
* common name:
 
* common name:
−
** (2E,9Z)-octadecenoyl-CoA
+
** ribonucleoside-diphosphate_reductase
−
* molecular weight:
+
* ec number:
−
** 1025.937   
+
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 18:2-Δ2,Δ9-CoA
 
−
** 2-trans,9-cis-octadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-17775]]
+
** 1 [[UDP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[DUDP]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 UDP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 dUDP[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10138]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_9916]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_9915]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_10617]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
 +
** '''12''' reactions found over '''17''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J}}
+
{{#set: common name=ribonucleoside-diphosphate_reductase}}
−
{{#set: common name=(2E,9Z)-octadecenoyl-CoA}}
+
{{#set: ec number=EC-1.17.4.1}}
−
{{#set: molecular weight=1025.937    }}
+
{{#set: gene associated=Tiso_gene_10138|Tiso_gene_9916|Tiso_gene_9915|Tiso_gene_10617}}
−
{{#set: common name=18:2-Δ2,Δ9-CoA|2-trans,9-cis-octadecenoyl-CoA}}
+
{{#set: in pathway=PWY0-166}}
−
{{#set: produced by=RXN-17775}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=esiliculosus}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}

Revision as of 17:33, 10 January 2018

Reaction RXN0-722

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ribonucleoside-diphosphate_reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-166, superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): PWY0-166
    • 12 reactions found over 17 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9531&oldid=18336"