Difference between revisions of "RXN66-161"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] == * smiles: ** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12875 == * left end position: ** 73 * transcription direction: ** POSITIVE * right end position: ** 3590 * centisome position: ** 1.0952739...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] ==
+
== Gene Tiso_gene_12875 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** 73
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** OPC4-trans-2-enoyl-CoA
+
** 3590
−
* molecular weight:
+
* centisome position:
−
** 981.797    
+
** 1.0952739    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10705]]
+
* [[3.4.21.4-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-10707]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-17832]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7797]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=73}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237329 44237329]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: right end position=3590}}
−
{{#set: inchi key=InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J}}
+
{{#set: centisome position=1.0952739   }}
−
{{#set: common name=OPC4-trans-2-enoyl-CoA}}
+
{{#set: reaction associated=3.4.21.4-RXN|RXN-17832}}
−
{{#set: molecular weight=981.797   }}
+
{{#set: pathway associated=PWY-7797}}
−
{{#set: consumed by=RXN-10705}}
+
−
{{#set: produced by=RXN-10707}}
+

Revision as of 17:34, 10 January 2018

Gene Tiso_gene_12875

  • left end position:
    • 73
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3590
  • centisome position:
    • 1.0952739
  • Synonym(s):

Reactions associated

  • 3.4.21.4-RXN
    • in-silico_annotation
      • automated-name-match
  • RXN-17832
    • in-silico_annotation
      • automated-name-match

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-161&oldid=18411"