Difference between revisions of "Tiso gene 15654"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13061 RXN-13061] == * direction: ** LEFT-TO-RIGHT * common name: ** tyrosinase * ec number: **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13061 RXN-13061] ==
−
* smiles:
+
* direction:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
+
 
* common name:
 
* common name:
−
** molybdopterin adenine dinucleotide
+
** tyrosinase
−
* molecular weight:
+
* ec number:
−
** 721.529   
+
** [http://enzyme.expasy.org/EC/1.10.3 EC-1.10.3]
 
* Synonym(s):
 
* Synonym(s):
−
** adenylated molybdopterin
 
−
** H2Dtpp-mADP
 
−
** molybdopterin-AMP
 
−
** adenylyl-molybdopterin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8348]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 2 [[L-DIHYDROXY-PHENYLALANINE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[DOPAQUINONE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 L-dopa[c] '''+''' 1 oxygen[c] '''=>''' 2 H2O[c] '''+''' 2 dopaquinone[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_1791]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5399]], betacyanin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5399 PWY-5399]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34287 34287]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00045 R00045]
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
+
{{#set: common name=tyrosinase}}
−
{{#set: common name=molybdopterin adenine dinucleotide}}
+
{{#set: ec number=EC-1.10.3}}
−
{{#set: molecular weight=721.529    }}
+
{{#set: gene associated=Tiso_gene_1791}}
−
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
+
{{#set: in pathway=PWY-5399}}
−
{{#set: consumed by=RXN-8348}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=in-silico_annotation}}

Revision as of 18:34, 10 January 2018

Reaction RXN-13061

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • tyrosinase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5399, betacyanin biosynthesis: PWY-5399
    • 3 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15654&oldid=18445"