Difference between revisions of "RXN66-336"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sterols Sterols] == * common name: ** a sterol * Synonym(s): == Reaction(s) known to consume t...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBINAMIDE-GDP ADENOSYLCOBINAMIDE-GDP] == * smiles: ** CC(OP([O-])(=O)OP(=O)([O-])OCC1(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBINAMIDE-GDP ADENOSYLCOBINAMIDE-GDP] == |
+ | * smiles: | ||
+ | ** CC(OP([O-])(=O)OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))CNC(=O)CCC%11(C)(C(CC(=O)N)C%13(C%14(C)(C(C)(CC(N)=O)C(CCC(N)=O)C7(=[N+]([Co--]8%12(CC6(C(O)C(C(N5(C=NC4(C(N)=NC=NC=45)))O6)O))([N+]%10(C(=CC9(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)7)[N+]8=9))C(C)(C)C(CCC(N)=O)C=%10C(C)=C%11N%12%13)))%14)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=IQTYKHRKNGVJEO-RRMAJTJESA-K | ||
* common name: | * common name: | ||
− | ** | + | ** adenosylcobinamide-GDP |
+ | * molecular weight: | ||
+ | ** 1663.504 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Adenosine-GDP-cobinamide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[COBALAMINSYN-RXN]] |
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed or produced by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06510 C06510] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60487 60487] | ||
+ | * BIGG : agdpcbi | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678596 70678596] | ||
+ | * HMDB : HMDB12185 | ||
+ | {{#set: smiles=CC(OP([O-])(=O)OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))CNC(=O)CCC%11(C)(C(CC(=O)N)C%13(C%14(C)(C(C)(CC(N)=O)C(CCC(N)=O)C7(=[N+]([Co--]8%12(CC6(C(O)C(C(N5(C=NC4(C(N)=NC=NC=45)))O6)O))([N+]%10(C(=CC9(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)7)[N+]8=9))C(C)(C)C(CCC(N)=O)C=%10C(C)=C%11N%12%13)))%14))))}} | ||
+ | {{#set: inchi key=InChIKey=IQTYKHRKNGVJEO-RRMAJTJESA-K}} | ||
+ | {{#set: common name=adenosylcobinamide-GDP}} | ||
+ | {{#set: molecular weight=1663.504 }} | ||
+ | {{#set: common name=Adenosine-GDP-cobinamide}} | ||
+ | {{#set: consumed or produced by=COBALAMINSYN-RXN}} |
Revision as of 18:34, 10 January 2018
Contents
Metabolite ADENOSYLCOBINAMIDE-GDP
- smiles:
- CC(OP([O-])(=O)OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))CNC(=O)CCC%11(C)(C(CC(=O)N)C%13(C%14(C)(C(C)(CC(N)=O)C(CCC(N)=O)C7(=[N+]([Co--]8%12(CC6(C(O)C(C(N5(C=NC4(C(N)=NC=NC=45)))O6)O))([N+]%10(C(=CC9(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)7)[N+]8=9))C(C)(C)C(CCC(N)=O)C=%10C(C)=C%11N%12%13)))%14))))
- inchi key:
- InChIKey=IQTYKHRKNGVJEO-RRMAJTJESA-K
- common name:
- adenosylcobinamide-GDP
- molecular weight:
- 1663.504
- Synonym(s):
- Adenosine-GDP-cobinamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(OP([O-])(=O)OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))CNC(=O)CCC%11(C)(C(CC(=O)N)C%13(C%14(C)(C(C)(CC(N)=O)C(CCC(N)=O)C7(=[N+]([Co--]8%12(CC6(C(O)C(C(N5(C=NC4(C(N)=NC=NC=45)))O6)O))([N+]%10(C(=CC9(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)7)[N+]8=9))C(C)(C)C(CCC(N)=O)C=%10C(C)=C%11N%12%13)))%14))))" cannot be used as a page name in this wiki.