Difference between revisions of "RXN-13680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acetoxy-Arylamines N-Acetoxy-Arylamines] == * common name: ** an N-acetoxyarylamine * Synonym...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acetoxy-Arylamines N-Acetoxy-Arylamines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] ==
 +
* smiles:
 +
** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
 +
* inchi key:
 +
** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
 
* common name:
 
* common name:
** an N-acetoxyarylamine
+
** geranylgeranyl chlorophyll a
 +
* molecular weight:
 +
** 886.447   
 
* Synonym(s):
 
* Synonym(s):
** N-acetoxyarylamine
+
** geranylgeranyl-chl a
 +
** GG-chl a
 +
** GG-chlorophyll a
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7664]]
 +
* [[RXN-17428]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.118-RXN]]
+
* [[RXN-7663]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an N-acetoxyarylamine}}
+
* PUBCHEM:
{{#set: common name=N-acetoxyarylamine}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538]
{{#set: produced by=2.3.1.118-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668]
 +
{{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}}
 +
{{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}}
 +
{{#set: common name=geranylgeranyl chlorophyll a}}
 +
{{#set: molecular weight=886.447    }}
 +
{{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}}
 +
{{#set: consumed by=RXN-7664|RXN-17428}}
 +
{{#set: produced by=RXN-7663}}

Revision as of 18:34, 10 January 2018

Metabolite CPD-7005

  • smiles:
    • C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
  • inchi key:
    • InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
  • common name:
    • geranylgeranyl chlorophyll a
  • molecular weight:
    • 886.447
  • Synonym(s):
    • geranylgeranyl-chl a
    • GG-chl a
    • GG-chlorophyll a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))" cannot be used as a page name in this wiki.