Difference between revisions of "RXN1G-260"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-GLYCEROL-P L-1-PHOSPHATIDYL-GLYCEROL-P] == * common name: ** 1-(3-sn-phosphati...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] == * smiles: ** C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] == |
| + | * smiles: | ||
| + | ** C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** 5',5'''-diadenosine tetraphosphate |
| + | * molecular weight: | ||
| + | ** 832.36 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** Ap4A | ||
| + | ** AppppA | ||
| + | ** P(1),P(4)-bis(5'-adenosyl)tetraphosphate | ||
| + | ** P1,P4-bis(5'-adenosyl)tetraphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.6.1.41-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : ap4a |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243905 25243905] |
| + | * HMDB : HMDB01211 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01260 C01260] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58141 58141] | ||
| + | * METABOLIGHTS : MTBLC58141 | ||
| + | {{#set: smiles=C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J}} | ||
| + | {{#set: common name=5',5'''-diadenosine tetraphosphate}} | ||
| + | {{#set: molecular weight=832.36 }} | ||
| + | {{#set: common name=Ap4A|AppppA|P(1),P(4)-bis(5'-adenosyl)tetraphosphate|P1,P4-bis(5'-adenosyl)tetraphosphate}} | ||
| + | {{#set: consumed by=3.6.1.41-RXN}} | ||
Revision as of 18:35, 10 January 2018
Contents
Metabolite ADENOSYL-P4
- smiles:
- C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O
- inchi key:
- InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J
- common name:
- 5',5-diadenosine tetraphosphate
- molecular weight:
- 832.36
- Synonym(s):
- Ap4A
- AppppA
- P(1),P(4)-bis(5'-adenosyl)tetraphosphate
- P1,P4-bis(5'-adenosyl)tetraphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : ap4a
- PUBCHEM:
- HMDB : HMDB01211
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58141
"C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
