Difference between revisions of "Tiso gene 13527"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15232 == * left end position: ** 612 * transcription direction: ** POSITIVE * right end position: ** 2829 * centisome position: ** 11.87197...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_15232 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
−
* left end position:
+
* smiles:
−
** 612
+
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
−
* right end position:
+
* common name:
−
** 2829
+
** 8-oxo-dGMP
−
* centisome position:
+
* molecular weight:
−
** 11.871970    
+
** 361.207    
 
* Synonym(s):
 
* Synonym(s):
 +
** 8-oxo-7,8-dihydro-2'-dGMP
 +
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
 +
** 8-oxo-deoxyguanosine-monophosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.7.1.133-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
−
***ec-number
+
* [[RXN-14205]]
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[2.7.1.134-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[2.7.1.139-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-6366]]
+
−
* [[PWY-4661]]
+
−
* [[PWY-6365]]
+
−
* [[PWY-6362]]
+
−
* [[PWY-6554]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=612}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535]
−
{{#set: right end position=2829}}
+
* CHEBI:
−
{{#set: centisome position=11.871970   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224]
−
{{#set: reaction associated=2.7.1.133-RXN|2.7.1.134-RXN|2.7.1.139-RXN}}
+
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
−
{{#set: pathway associated=PWY-6366|PWY-4661|PWY-6365|PWY-6362|PWY-6554}}
+
{{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}}
 +
{{#set: common name=8-oxo-dGMP}}
 +
{{#set: molecular weight=361.207   }}
 +
{{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}}
 +
{{#set: consumed or produced by=RXN-14205}}

Revision as of 17:35, 10 January 2018

Metabolite CPD-12365

  • smiles:
    • C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
  • common name:
    • 8-oxo-dGMP
  • molecular weight:
    • 361.207
  • Synonym(s):
    • 8-oxo-7,8-dihydro-2'-dGMP
    • 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
    • 8-oxo-deoxyguanosine-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13527&oldid=18529"