Difference between revisions of "CPD0-1425"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-FA 2-Me-Branched-234-Sat-FA] == * common name: ** a 2-methyl branched 2,3...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == * smiles: ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-FA 2-Me-Branched-234-Sat-FA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] ==
 +
* smiles:
 +
** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
 +
* inchi key:
 +
** InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
 
* common name:
 
* common name:
** a 2-methyl branched 2,3,4-saturated fatty acid
+
** dihydrodemethylsterigmatocystin
 +
* molecular weight:
 +
** 312.278   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-483]]
+
* [[RXN-9500]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-472]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a 2-methyl branched 2,3,4-saturated fatty acid}}
+
* LIGAND-CPD:
{{#set: consumed by=RXN66-483}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C20444 C20444]
{{#set: produced by=RXN66-472}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4588953.html 4588953]
 +
* HMDB : HMDB33658
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20832874 20832874]
 +
{{#set: smiles=C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))}}
 +
{{#set: inchi key=InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N}}
 +
{{#set: common name=dihydrodemethylsterigmatocystin}}
 +
{{#set: molecular weight=312.278    }}
 +
{{#set: consumed by=RXN-9500}}

Revision as of 17:35, 10 January 2018

Metabolite CPD-4586

  • smiles:
    • C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
  • inchi key:
    • InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
  • common name:
    • dihydrodemethylsterigmatocystin
  • molecular weight:
    • 312.278
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))" cannot be used as a page name in this wiki.