Difference between revisions of "CPD0-1425"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-FA 2-Me-Branched-234-Sat-FA] == * common name: ** a 2-methyl branched 2,3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == * smiles: ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == |
+ | * smiles: | ||
+ | ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N | ||
* common name: | * common name: | ||
− | ** | + | ** dihydrodemethylsterigmatocystin |
+ | * molecular weight: | ||
+ | ** 312.278 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9500]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20444 C20444] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.4588953.html 4588953] | ||
+ | * HMDB : HMDB33658 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20832874 20832874] | ||
+ | {{#set: smiles=C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))}} | ||
+ | {{#set: inchi key=InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N}} | ||
+ | {{#set: common name=dihydrodemethylsterigmatocystin}} | ||
+ | {{#set: molecular weight=312.278 }} | ||
+ | {{#set: consumed by=RXN-9500}} |
Revision as of 17:35, 10 January 2018
Contents
Metabolite CPD-4586
- smiles:
- C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
- inchi key:
- InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
- common name:
- dihydrodemethylsterigmatocystin
- molecular weight:
- 312.278
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))" cannot be used as a page name in this wiki.