Difference between revisions of "TransportSeed CPD-3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=m7G5-pppR-mRNAs m7G5-pppR-mRNAs] == * common name: ** a 5'-(N7-methyl 5'-triphosphoguanosine)-(...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=m7G5-pppR-mRNAs m7G5-pppR-mRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] ==
 +
* smiles:
 +
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
 
* common name:
 
* common name:
−
** a 5'-(N7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mRNA]
+
** campestanol
 +
* molecular weight:
 +
** 402.702   
 
* Synonym(s):
 
* Synonym(s):
−
** an m7G(5')pppR-[mRNA]
+
** 5α-campestanol
−
** guanine7-methylated mRNA
+
−
** a 7-methylguanosine 5'-triphospho-5'-[mRNA]
+
−
** m7G5'ppp5'R-[mRNA]
+
−
** a 5'-(N7-methyl 5'-triphosphoguanosine )-[mRNA]
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-773]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: common name=a 5'-(N7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mRNA]}}
+
* PUBCHEM:
−
{{#set: common name=an m7G(5')pppR-[mRNA]|guanine7-methylated mRNA|a 7-methylguanosine 5'-triphospho-5'-[mRNA]|m7G5'ppp5'R-[mRNA]|a 5'-(N7-methyl 5'-triphosphoguanosine )-[mRNA]}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119394 119394]
−
{{#set: produced by=MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36799 36799]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787]
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}}
 +
{{#set: common name=campestanol}}
 +
{{#set: molecular weight=402.702    }}
 +
{{#set: common name=5α-campestanol}}
 +
{{#set: consumed by=RXN-773}}

Revision as of 18:37, 10 January 2018

Metabolite CPD-710

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
  • common name:
    • campestanol
  • molecular weight:
    • 402.702
  • Synonym(s):
    • 5α-campestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TransportSeed_CPD-3&oldid=18722"