Difference between revisions of "Tiso gene 13200"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14474 == * left end position: ** 261 * transcription direction: ** POSITIVE * right end position: ** 1585 * centisome position: ** 4.636702...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * inchi key: ** InChIKe...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=O)C(C)(O)C(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M |
| − | * | + | * common name: |
| − | ** | + | ** (S)-2-acetolactate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 131.108 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (S)-2-hydroxy-2-methyl-3-oxobutanoate | ||
| + | ** α-acetolactate | ||
| + | ** (2S)-2-hydroxy-2-methyl-3-oxobutanoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-6081]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[ACETOLACTSYN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[ACETOLACTREDUCTOISOM-RXN]] | |
| − | + | * [[RXN-14037]] | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770] |
| − | {{#set: | + | * HMDB : HMDB06855 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476] | ||
| + | * BIGG : alac__S | ||
| + | {{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}} | ||
| + | {{#set: common name=(S)-2-acetolactate}} | ||
| + | {{#set: molecular weight=131.108 }} | ||
| + | {{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|α-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}} | ||
| + | {{#set: consumed by=RXN-6081}} | ||
| + | {{#set: produced by=ACETOLACTSYN-RXN}} | ||
| + | {{#set: consumed or produced by=ACETOLACTREDUCTOISOM-RXN|RXN-14037}} | ||
Revision as of 17:38, 10 January 2018
Contents
Metabolite 2-ACETO-LACTATE
- smiles:
- CC(=O)C(C)(O)C(=O)[O-]
- inchi key:
- InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
- common name:
- (S)-2-acetolactate
- molecular weight:
- 131.108
- Synonym(s):
- (S)-2-hydroxy-2-methyl-3-oxobutanoate
- α-acetolactate
- (2S)-2-hydroxy-2-methyl-3-oxobutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB06855
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : alac__S
"CC(=O)C(C)(O)C(=O)[O-" cannot be used as a page name in this wiki.
