Difference between revisions of "RXN-13313"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HEMN-RXN HEMN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** coproporphyrinogen-iii_oxidas...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) * inchi key: **...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HEMN-RXN HEMN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)
 +
* inchi key:
 +
** InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L
 
* common name:
 
* common name:
−
** coproporphyrinogen-iii_oxidase
+
** 1D-myo-inositol 2-monophosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.98.3 EC-1.3.98.3]
+
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-myo-inositol 2-monophosphate
 +
** Ins(2)P1
 +
** Ins(2)P
 +
** Ins2P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7253]]
−
** 2 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[COPROPORPHYRINOGEN_III]][c] '''=>''' 2 [[CH33ADO]][c] '''+''' 1 [[PROTOPORPHYRINOGEN]][c] '''+''' 2 [[CARBON-DIOXIDE]][c] '''+''' 2 [[MET]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 S-adenosyl-L-methionine[c] '''+''' 1 coproporphyrinogen III[c] '''=>''' 2 5'-deoxyadenosine[c] '''+''' 1 protoporphyrinogen IX[c] '''+''' 2 CO2[c] '''+''' 2 L-methionine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18066]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_13364]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_5577]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_13365]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_4004]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5531]], 3,8-divinyl-chlorophyllide a biosynthesis II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5531 PWY-5531]
+
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
−
* [[HEMESYN2-PWY]], heme biosynthesis II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15425 15425]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62383 62383]
−
* LIGAND-RXN:
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R06895 R06895]
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=1D-myo-inositol 2-monophosphate}}
−
{{#set: common name=coproporphyrinogen-iii_oxidase}}
+
{{#set: molecular weight=258.121    }}
−
{{#set: ec number=EC-1.3.98.3}}
+
{{#set: common name=D-myo-inositol 2-monophosphate|Ins(2)P1|Ins(2)P|Ins2P}}
−
{{#set: gene associated=Tiso_gene_18066|Tiso_gene_13364|Tiso_gene_5577|Tiso_gene_13365|Tiso_gene_4004}}
+
{{#set: consumed by=RXN-7253}}
−
{{#set: in pathway=PWY-5531|HEMESYN2-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=synechocystis|athaliana|esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 17:39, 10 January 2018

Metabolite CPD-6746

  • smiles:
    • C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)
  • inchi key:
    • InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L
  • common name:
    • 1D-myo-inositol 2-monophosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • D-myo-inositol 2-monophosphate
    • Ins(2)P1
    • Ins(2)P
    • Ins2P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13313&oldid=18851"