Difference between revisions of "HEMN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-292 CPD-292] == * smiles: ** CCCCCCCCCCCCCC=C[CH]=O * inchi key: ** InChIKey=KLJFYXOVGVXZKT...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OCTAPRENYL-4-HYDROXYBENZOATE 3-OCTAPRENYL-4-HYDROXYBENZOATE] == * smiles: ** CC(=CCCC(=CCCC(=...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OCTAPRENYL-4-HYDROXYBENZOATE 3-OCTAPRENYL-4-HYDROXYBENZOATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UTIBHEBNILDQKX-LQOKPSQISA-M |
* common name: | * common name: | ||
| − | ** | + | ** 3-octaprenyl-4-hydroxybenzoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 682.06 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54685638 54685638] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.5256806.html 5256806] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1617 1617] |
| − | {{#set: smiles= | + | * BIGG : 3ophb |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05809 C05809] |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C}} |
| − | + | {{#set: inchi key=InChIKey=UTIBHEBNILDQKX-LQOKPSQISA-M}} | |
| − | {{#set: produced by= | + | {{#set: common name=3-octaprenyl-4-hydroxybenzoate}} |
| + | {{#set: molecular weight=682.06 }} | ||
| + | {{#set: produced by=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN}} | ||
Revision as of 18:39, 10 January 2018
Contents
Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=UTIBHEBNILDQKX-LQOKPSQISA-M
- common name:
- 3-octaprenyl-4-hydroxybenzoate
- molecular weight:
- 682.06
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.
