Difference between revisions of "FLAVONADPREDUCT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-171 RXN-171] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-171 RXN-171] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
+
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
* common name:
+
** dioleoyl phosphatidate
+
* molecular weight:
+
** 698.959   
+
 
* Synonym(s):
 
* Synonym(s):
** 18:1-18:1-PA
 
** 1-18:1-2-18:1-phosphatidic acid
 
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
 
** 1-18:1-2-18:1-phosphatidate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-15068]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-134]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CPD-482]][c]
* [[RXN-15043]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 oxygen[c] '''+''' 1 gibberellin A9[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 CO2[c] '''+''' 1 succinate[c] '''+''' 1 gibberellin A51[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3330]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-102]], gibberellin inactivation I (2β-hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102]
 +
** '''4''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71627209 71627209]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06337 R06337]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308]
+
{{#set: ec number=EC-1.14.11}}
* HMDB : HMDB07865
+
{{#set: gene associated=Tiso_gene_3330}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}}
+
{{#set: in pathway=PWY-102}}
{{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=dioleoyl phosphatidate}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
{{#set: molecular weight=698.959    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}}
+
{{#set: consumed by=RXN-15068}}
+
{{#set: produced by=RXN-15043}}
+

Revision as of 17:53, 18 March 2018

Reaction RXN-171

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-102, gibberellin inactivation I (2β-hydroxylation): PWY-102
    • 4 reactions found over 11 reactions in the full pathway

Reconstruction information

External links