Difference between revisions of "GLCURK"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLCURK GLCURK] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucuronokinase * Synonym(s): ==...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLCURK GLCURK] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
 +
* inchi key:
 +
** InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
 
* common name:
 
* common name:
−
** Glucuronokinase
+
** 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
 +
* molecular weight:
 +
** 821.32   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9235]]
−
** 1.0 [[ATP]][c] '''+''' 1.0 [[D-Glucopyranuronate]][c] '''=>''' 1.0 [[CPD-510]][c] '''+''' 1.0 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 ATP[c] '''+''' 1.0 D-glucopyranuronate[c] '''=>''' 1.0 α-D-glucuronate 1-phosphate[c] '''+''' 1.0 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12191]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Glucuronokinase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986248 50986248]
−
{{#set: gene associated=Tiso_gene_12191}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol}}
 +
{{#set: molecular weight=821.32    }}
 +
{{#set: common name=2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol}}
 +
{{#set: consumed by=RXN-9235}}

Revision as of 18:53, 18 March 2018

Metabolite CPD-9869

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
  • inchi key:
    • InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
  • common name:
    • 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
  • molecular weight:
    • 821.32
  • Synonym(s):
    • 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLCURK&oldid=20458"