Difference between revisions of "Tiso gene 17230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUTDEG-PWY GLUTDEG-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))
 +
* inchi key:
 +
** InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M
 
* common name:
 
* common name:
** L-glutamate degradation II
+
** L-thyroxine acyl β-D-glucuronide
 +
* molecular weight:
 +
** 951.992   
 
* Synonym(s):
 
* Synonym(s):
** L-aspartate degradation
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''2''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[ASPAMINOTRANS-RXN]]
+
* [[RXN-10608]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* [http://metacyc.org/META/NEW-IMAGE?object=ASPARTASE-RXN ASPARTASE-RXN]
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* PUBCHEM:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLUTDEG-PWY GLUTDEG-PWY]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657991 90657991]
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))}}
{{#set: common name=L-glutamate degradation II}}
+
{{#set: inchi key=InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M}}
{{#set: common name=L-aspartate degradation}}
+
{{#set: common name=L-thyroxine acyl β-D-glucuronide}}
{{#set: reaction found=1}}
+
{{#set: molecular weight=951.992    }}
{{#set: reaction not found=2}}
+
{{#set: produced by=RXN-10608}}
{{#set: completion rate=50.0}}
+

Revision as of 18:54, 18 March 2018

Metabolite CPD-11401

  • smiles:
    • C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))
  • inchi key:
    • InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M
  • common name:
    • L-thyroxine acyl β-D-glucuronide
  • molecular weight:
    • 951.992
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))" cannot be used as a page name in this wiki.