Difference between revisions of "Dodecanoyl-ACPs"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9549 RXN-9549] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == |
| − | * | + | * smiles: |
| − | ** | + | ** [CH](=O)C(O)C(O)C(O)CO |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N |
| + | * common name: | ||
| + | ** aldehydo-L-arabinose | ||
| + | * molecular weight: | ||
| + | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14102]] | |
| − | + | * [[RXN-14808]] | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291] |
| − | * LIGAND- | + | * CHEBI: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476] | |
| − | {{#set: | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}} |
| − | {{#set: | + | {{#set: common name=aldehydo-L-arabinose}} |
| − | {{#set: | + | {{#set: molecular weight=150.131 }} |
| + | {{#set: reversible reaction associated=RXN-14102|RXN-14808}} | ||
Revision as of 18:54, 18 March 2018
Contents
Metabolite CPD-15699
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
- common name:
- aldehydo-L-arabinose
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.
