Difference between revisions of "RXN-12195"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP CMP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP([O-])([O-])=O * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7141 PWY-7141] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7141 PWY-7141] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (3S)-linalool biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (S)-linalool biosynthesis |
| − | ** | + | ** S-(+)-linalool biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
| − | + | * [[GPPSYN-RXN]] | |
| − | * | + | ** 9 associated gene(s): |
| − | * | + | *** [[Tiso_gene_19542]] |
| − | + | *** [[Tiso_gene_18201]] | |
| − | + | *** [[Tiso_gene_16284]] | |
| − | * | + | *** [[Tiso_gene_2848]] |
| − | * | + | *** [[Tiso_gene_1035]] |
| − | * [[ | + | *** [[Tiso_gene_4719]] |
| − | * | + | *** [[Tiso_gene_11582]] |
| − | * | + | *** [[Tiso_gene_13582]] |
| − | * [[ | + | *** [[Tiso_gene_10317]] |
| − | * | + | ** 5 reconstruction source(s) associated: |
| − | * | + | *** [[orthology-athaliana]] |
| − | * [[ | + | *** [[orthology-creinhardtii]] |
| − | * [[ | + | *** [[orthology-synechocystis]] |
| − | * [[ | + | *** [[orthology-esiliculosus]] |
| − | * | + | *** [[manual-primary_network]] |
| − | * [[ | + | == Reaction(s) not found == |
| − | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.25-RXN 4.2.3.25-RXN] |
| − | * [[ | + | |
| − | * [[ | + | |
| − | * | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=(3S)-linalool biosynthesis}} | |
| − | + | {{#set: common name=(S)-linalool biosynthesis|S-(+)-linalool biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 17:54, 18 March 2018
Pathway PWY-7141
- taxonomic range:
- common name:
- (3S)-linalool biosynthesis
- Synonym(s):
- (S)-linalool biosynthesis
- S-(+)-linalool biosynthesis
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- GPPSYN-RXN
- 9 associated gene(s):
- 5 reconstruction source(s) associated:
