Difference between revisions of "PWY-6087"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14404 CPD-14404] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6613 PWY-6613] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14404 CPD-14404] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6613 PWY-6613] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=DJFXNRBQUUFIOS-DDQUOPDJSA-J
+
 
* common name:
 
* common name:
** 3-oxo-dihomo γ-linolenoyl-CoA
+
** tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate
* molecular weight:
+
** 1065.958   
+
 
* Synonym(s):
 
* Synonym(s):
** (8Z,11Z,14Z)-3-oxo-icosa-8,11,14-trienoyl-CoA
+
** folic acid salvage
** (8Z,11Z,14Z)-3-oxo-icosatrienoyl-CoA
+
** folate salvage
 +
** THF salvage
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12968]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GART-RXN]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698343 70698343]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71481 71481]
+
{{#set: common name=folic acid salvage|folate salvage|THF salvage}}
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=2}}
{{#set: inchi key=InChIKey=DJFXNRBQUUFIOS-DDQUOPDJSA-J}}
+
{{#set: total reaction=2}}
{{#set: common name=3-oxo-dihomo γ-linolenoyl-CoA}}
+
{{#set: completion rate=100.0}}
{{#set: molecular weight=1065.958    }}
+
{{#set: common name=(8Z,11Z,14Z)-3-oxo-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-3-oxo-icosatrienoyl-CoA}}
+
{{#set: consumed by=RXN-12968}}
+

Revision as of 18:55, 18 March 2018

Pathway PWY-6613

  • taxonomic range:
  • common name:
    • tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate
  • Synonym(s):
    • folic acid salvage
    • folate salvage
    • THF salvage

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links