Difference between revisions of "RXN-4241"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12647 CPD-12647] == * smiles: ** CCC=CCC=CCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=R...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M |
* common name: | * common name: | ||
− | ** | + | ** L-gulonate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 195.149 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** gulonate |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8783]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857680 6857680] |
− | {{#set: smiles= | + | * CHEMSPIDER: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.5257015.html 5257015] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13115 13115] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC13115 |
− | + | * LIGAND-CPD: | |
− | {{#set: produced by=RXN- | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00800 C00800] |
+ | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M}} | ||
+ | {{#set: common name=L-gulonate}} | ||
+ | {{#set: molecular weight=195.149 }} | ||
+ | {{#set: common name=gulonate}} | ||
+ | {{#set: produced by=RXN-8783}} |
Revision as of 17:55, 18 March 2018
Contents
Metabolite L-GULONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M
- common name:
- L-gulonate
- molecular weight:
- 195.149
- Synonym(s):
- gulonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.